C20H14ClF3N2O6S — CID 16874318
ethyl 1-(2-chlorophenyl)-6-oxo-4-[2-(trifluoromethyl)phenyl]sulfonyloxypyridazine-3-carboxylate (PubChem CID 16874318) has the molecular formula C20H14ClF3N2O6S and a molecular weight of 502.85 g/mol. Its IUPAC name is ethyl 1-(2-chlorophenyl)-6-oxo-4-[2-(trifluoromethyl)phenyl]sulfonyloxypyridazine-3-carboxylate.
| Compound Name | ethyl 1-(2-chlorophenyl)-6-oxo-4-[2-(trifluoromethyl)phenyl]sulfonyloxypyridazine-3-carboxylate |
|---|---|
| PubChem CID | 16874318 |
| Molecular Formula | C20H14ClF3N2O6S |
| Molecular Weight | 502.85 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | ethyl 1-(2-chlorophenyl)-6-oxo-4-[2-(trifluoromethyl)phenyl]sulfonyloxypyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2Cl)c(=O)cc1OS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H14ClF3N2O6S/c1-2-31-19(28)18-15(11-17(27)26(25-18)14-9-5-4-8-13(14)21)32-33(29,30)16-10-6-3-7-12(16)20(22,23)24/h3-11H,2H2,1H3 |
| InChIKey | BPALUOZXDPZTOF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|