C17H32F4NO6+ — CID 168743915
4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-(2,2,3,3-tetrafluoropropoxy)propyl]morpholin-4-ium (PubChem CID 168743915) has the molecular formula C17H32F4NO6+ and a molecular weight of 422.44 g/mol. Its IUPAC name is 4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-(2,2,3,3-tetrafluoropropoxy)propyl]morpholin-4-ium.
| Compound Name | 4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-(2,2,3,3-tetrafluoropropoxy)propyl]morpholin-4-ium |
|---|---|
| PubChem CID | 168743915 |
| Molecular Formula | C17H32F4NO6+ |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-(2,2,3,3-tetrafluoropropoxy)propyl]morpholin-4-ium |
| SMILES | COCCOCCOCCOC(COCC(F)(F)C(F)F)C[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H31F4NO6/c1-23-6-7-25-8-9-26-10-11-28-15(12-22-2-4-24-5-3-22)13-27-14-17(20,21)16(18)19/h15-16H,2-14H2,1H3/p+1 |
| InChIKey | JDVUSVMWKPWXAO-UHFFFAOYSA-O |
| XLogP | -0.12 |
| TPSA | 59.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|