C20H16BrClN2O4 — CID 16874434
ethyl 1-(3-bromophenyl)-4-[(2-chlorophenyl)methoxy]-6-oxopyridazine-3-carboxylate (PubChem CID 16874434) has the molecular formula C20H16BrClN2O4 and a molecular weight of 463.72 g/mol. Its IUPAC name is ethyl 1-(3-bromophenyl)-4-[(2-chlorophenyl)methoxy]-6-oxopyridazine-3-carboxylate.
| Compound Name | ethyl 1-(3-bromophenyl)-4-[(2-chlorophenyl)methoxy]-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 16874434 |
| Molecular Formula | C20H16BrClN2O4 |
| Molecular Weight | 463.72 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | ethyl 1-(3-bromophenyl)-4-[(2-chlorophenyl)methoxy]-6-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2cccc(Br)c2)c(=O)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H16BrClN2O4/c1-2-27-20(26)19-17(28-12-13-6-3-4-9-16(13)22)11-18(25)24(23-19)15-8-5-7-14(21)10-15/h3-11H,2,12H2,1H3 |
| InChIKey | ZCHBYJRWTYTTQH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |