About 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene
4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene (PubChem CID 168745587) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene.
Molecular Properties
| Compound Name | 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene |
| PubChem CID | 168745587 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene |
| SMILES | C=CCC(C#COCC)(CC)CC(=C)C |
| InChI | InChI=1S/C14H22O/c1-6-9-14(7-2,12-13(4)5)10-11-15-8-3/h6H,1,4,7-9,12H2,2-3,5H3 |
| InChIKey | XIMNZKYOHFMXEY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene?
The IUPAC name of 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene (CID 168745587) is 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene.
What is the SMILES notation for 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene?
The canonical SMILES for 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene is C=CCC(C#COCC)(CC)CC(=C)C.
What is the InChIKey of 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene?
The InChIKey is XIMNZKYOHFMXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-6-9-14(7-2,12-13(4)5)10-11-15-8-3/h6H,1,4,7-9,12H2,2-3,5H3.
What are the key properties of 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene?
4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene has a molecular weight of 206.33 g/mol, XLogP of 3.92, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethoxyethynyl)-4-ethyl-2-methylhepta-1,6-diene is sourced from PubChem (CID 168745587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).