C41H25N5O — CID 168746371
2-dibenzofuran-3-yl-3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoxaline (PubChem CID 168746371) has the molecular formula C41H25N5O and a molecular weight of 603.69 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoxaline.
| Compound Name | 2-dibenzofuran-3-yl-3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoxaline |
|---|---|
| PubChem CID | 168746371 |
| Molecular Formula | C41H25N5O |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | 2-dibenzofuran-3-yl-3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoxaline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4nc5ccccc5nc4-c4ccc5c(c4)oc4ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C41H25N5O/c1-3-12-26(13-4-1)39-44-40(27-14-5-2-6-15-27)46-41(45-39)30-17-11-16-28(24-30)37-38(43-34-20-9-8-19-33(34)42-37)29-22-23-32-31-18-7-10-21-35(31)47-36(32)25-29/h1-25H |
| InChIKey | UTOGSMSFXQLWCU-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |