C17H9N5S — CID 168746598
4-quinolin-8-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 168746598) has the molecular formula C17H9N5S and a molecular weight of 315.36 g/mol. Its IUPAC name is 4-quinolin-8-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 4-quinolin-8-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 168746598 |
| Molecular Formula | C17H9N5S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-quinolin-8-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | c1cnc2c(-c3ncc4sc5nccnc5c4n3)cccc2c1 |
| InChI | InChI=1S/C17H9N5S/c1-3-10-4-2-6-18-13(10)11(5-1)16-21-9-12-14(22-16)15-17(23-12)20-8-7-19-15/h1-9H |
| InChIKey | KVCYATHLMFVLLY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |