C21H20N6O4 — CID 168747328
3-[3-[3-ethoxy-4-(7-oxo-2,6-dihydrotriazolo[4,5-d]pyrimidin-5-yl)phenyl]phenyl]-N-hydroxypropanamide (PubChem CID 168747328) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is 3-[3-[3-ethoxy-4-(7-oxo-2,6-dihydrotriazolo[4,5-d]pyrimidin-5-yl)phenyl]phenyl]-N-hydroxypropanamide.
| Compound Name | 3-[3-[3-ethoxy-4-(7-oxo-2,6-dihydrotriazolo[4,5-d]pyrimidin-5-yl)phenyl]phenyl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 168747328 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-[3-[3-ethoxy-4-(7-oxo-2,6-dihydrotriazolo[4,5-d]pyrimidin-5-yl)phenyl]phenyl]-N-hydroxypropanamide |
| SMILES | CCOc1cc(-c2cccc(CCC(=O)NO)c2)ccc1-c1nc2n[nH]nc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H20N6O4/c1-2-31-16-11-14(13-5-3-4-12(10-13)6-9-17(28)26-30)7-8-15(16)19-22-20-18(21(29)23-19)24-27-25-20/h3-5,7-8,10-11,30H,2,6,9H2,1H3,(H,26,28)(H2,22,23,24,25,27,29) |
| InChIKey | NAEFWLSLYUDTQU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 145.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|