About N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide
N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide (PubChem CID 168747559) has the molecular formula C19H33N3O3
and a molecular weight of 351.49 g/mol. Its IUPAC name is N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide.
Molecular Properties
| Compound Name | N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide |
| PubChem CID | 168747559 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide |
| SMILES | CC(C)(C)NNC(=O)CCCCCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H33N3O3/c1-19(2,3)21-20-16(23)12-10-8-6-4-5-7-9-11-15-22-17(24)13-14-18(22)25/h13-14,21H,4-12,15H2,1-3H3,(H,20,23) |
| InChIKey | GSRKOTOAVQXQGP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide?
The IUPAC name of N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide (CID 168747559) is N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide.
What is the SMILES notation for N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide?
The canonical SMILES for N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide is CC(C)(C)NNC(=O)CCCCCCCCCCN1C(=O)C=CC1=O.
What is the InChIKey of N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide?
The InChIKey is GSRKOTOAVQXQGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N3O3/c1-19(2,3)21-20-16(23)12-10-8-6-4-5-7-9-11-15-22-17(24)13-14-18(22)25/h13-14,21H,4-12,15H2,1-3H3,(H,20,23).
What are the key properties of N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide?
N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide has a molecular weight of 351.49 g/mol, XLogP of 2.84, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-11-(2,5-dioxopyrrol-1-yl)undecanehydrazide is sourced from PubChem (CID 168747559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).