C22H34O8P2 — CID 168749406
phosphono [2-[(2E,6E)-3,6,11-trimethyldodeca-2,6,10-trienoxy]phenyl]methyl hydrogen phosphate (PubChem CID 168749406) has the molecular formula C22H34O8P2 and a molecular weight of 488.45 g/mol. Its IUPAC name is phosphono [2-[(2E,6E)-3,6,11-trimethyldodeca-2,6,10-trienoxy]phenyl]methyl hydrogen phosphate.
| Compound Name | phosphono [2-[(2E,6E)-3,6,11-trimethyldodeca-2,6,10-trienoxy]phenyl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 168749406 |
| Molecular Formula | C22H34O8P2 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | phosphono [2-[(2E,6E)-3,6,11-trimethyldodeca-2,6,10-trienoxy]phenyl]methyl hydrogen phosphate |
| SMILES | CC(C)=CCC/C=C(\C)CC/C(C)=C/COc1ccccc1COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C22H34O8P2/c1-18(2)9-5-6-10-19(3)13-14-20(4)15-16-28-22-12-8-7-11-21(22)17-29-32(26,27)30-31(23,24)25/h7-12,15H,5-6,13-14,16-17H2,1-4H3,(H,26,27)(H2,23,24,25)/b19-10+,20-15+ |
| InChIKey | NXGISIXXKHZBJF-HUILQHJWSA-N |
| XLogP | 6.21 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|