C22H26F6N3O11P — CID 168749885
[1-fluoro-2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[2-[1-[2-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]ethyl]triazol-4-yl]ethoxy]oxan-2-yl]ethyl]phosphonic acid (PubChem CID 168749885) has the molecular formula C22H26F6N3O11P and a molecular weight of 653.42 g/mol. Its IUPAC name is [1-fluoro-2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[2-[1-[2-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]ethyl]triazol-4-yl]ethoxy]oxan-2-yl]ethyl]phosphonic acid.
| Compound Name | [1-fluoro-2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[2-[1-[2-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]ethyl]triazol-4-yl]ethoxy]oxan-2-yl]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 168749885 |
| Molecular Formula | C22H26F6N3O11P |
| Molecular Weight | 653.42 g/mol |
| Exact Mass | 653.12 |
| IUPAC Name | [1-fluoro-2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[2-[1-[2-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]ethyl]triazol-4-yl]ethoxy]oxan-2-yl]ethyl]phosphonic acid |
| SMILES | O=C(CCOCCn1cc(CCO[C@H]2O[C@H](CC(F)P(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]2O)nn1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H26F6N3O11P/c23-11(43(36,37)38)7-10-18(33)19(34)20(35)22(41-10)40-5-1-9-8-31(30-29-9)3-6-39-4-2-12(32)42-21-16(27)14(25)13(24)15(26)17(21)28/h8,10-11,18-20,22,33-35H,1-7H2,(H2,36,37,38)/t10-,11?,18-,19+,20+,22+/m1/s1 |
| InChIKey | IWRIHNHCAZUEGM-RCOUBSDESA-N |
| XLogP | 0.22 |
| TPSA | 202.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.42 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|