C23H22N+ — CID 168752236
4-(2-methylbutan-2-yl)-19-azoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene (PubChem CID 168752236) has the molecular formula C23H22N+ and a molecular weight of 312.44 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)-19-azoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene.
| Compound Name | 4-(2-methylbutan-2-yl)-19-azoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
|---|---|
| PubChem CID | 168752236 |
| Molecular Formula | C23H22N+ |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-(2-methylbutan-2-yl)-19-azoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
| SMILES | CCC(C)(C)c1ccc2c(c1)C1c3ccccc3-c3cccc-2[n+]31 |
| InChI | InChI=1S/C23H22N/c1-4-23(2,3)15-12-13-17-19(14-15)22-18-9-6-5-8-16(18)20-10-7-11-21(17)24(20)22/h5-14,22H,4H2,1-3H3/q+1 |
| InChIKey | HAHSMZKAPFOMDC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|