C16H13N5O3S — CID 168752717
6-[4-(4-isocyanophenyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]pyridine-3-sulfonamide (PubChem CID 168752717) has the molecular formula C16H13N5O3S and a molecular weight of 355.38 g/mol. Its IUPAC name is 6-[4-(4-isocyanophenyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]pyridine-3-sulfonamide.
| Compound Name | 6-[4-(4-isocyanophenyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 168752717 |
| Molecular Formula | C16H13N5O3S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 6-[4-(4-isocyanophenyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]pyridine-3-sulfonamide |
| SMILES | [C-]#[N+]c1ccc(-c2c(C)[nH]n(-c3ccc(S(N)(=O)=O)cn3)c2=O)cc1 |
| InChI | InChI=1S/C16H13N5O3S/c1-10-15(11-3-5-12(18-2)6-4-11)16(22)21(20-10)14-8-7-13(9-19-14)25(17,23)24/h3-9,20H,1H3,(H2,17,23,24) |
| InChIKey | BQNOHPLJUWHUSL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|