C13H20F2N3O3+ — CID 168753450
[(5S,8S,10aR)-5-amino-3-(2,2-difluoroethyl)-6-oxo-1,2,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,5]diazocine-8-carbonyl]-methylideneoxidanium (PubChem CID 168753450) has the molecular formula C13H20F2N3O3+ and a molecular weight of 304.32 g/mol. Its IUPAC name is [(5S,8S,10aR)-5-amino-3-(2,2-difluoroethyl)-6-oxo-1,2,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,5]diazocine-8-carbonyl]-methylideneoxidanium.
| Compound Name | [(5S,8S,10aR)-5-amino-3-(2,2-difluoroethyl)-6-oxo-1,2,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,5]diazocine-8-carbonyl]-methylideneoxidanium |
|---|---|
| PubChem CID | 168753450 |
| Molecular Formula | C13H20F2N3O3+ |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [(5S,8S,10aR)-5-amino-3-(2,2-difluoroethyl)-6-oxo-1,2,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,5]diazocine-8-carbonyl]-methylideneoxidanium |
| SMILES | C=[O+]C(=O)[C@@H]1CC[C@@H]2CCN(CC(F)F)C[C@H](N)C(=O)N21 |
| InChI | InChI=1S/C13H20F2N3O3/c1-21-13(20)10-3-2-8-4-5-17(7-11(14)15)6-9(16)12(19)18(8)10/h8-11H,1-7,16H2/q+1/t8-,9+,10+/m1/s1 |
| InChIKey | ROFRDRQXRLOXSZ-UTLUCORTSA-N |
| XLogP | -0.46 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|