C28H34FNO4 — CID 168754335
methyl (2S)-3-[7-butoxy-4-(4-fluorophenyl)-3-(1-methoxypropan-2-yl)quinolin-2-yl]-2-methylpropanoate (PubChem CID 168754335) has the molecular formula C28H34FNO4 and a molecular weight of 467.58 g/mol. Its IUPAC name is methyl (2S)-3-[7-butoxy-4-(4-fluorophenyl)-3-(1-methoxypropan-2-yl)quinolin-2-yl]-2-methylpropanoate.
| Compound Name | methyl (2S)-3-[7-butoxy-4-(4-fluorophenyl)-3-(1-methoxypropan-2-yl)quinolin-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 168754335 |
| Molecular Formula | C28H34FNO4 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | methyl (2S)-3-[7-butoxy-4-(4-fluorophenyl)-3-(1-methoxypropan-2-yl)quinolin-2-yl]-2-methylpropanoate |
| SMILES | CCCCOc1ccc2c(-c3ccc(F)cc3)c(C(C)COC)c(C[C@H](C)C(=O)OC)nc2c1 |
| InChI | InChI=1S/C28H34FNO4/c1-6-7-14-34-22-12-13-23-24(16-22)30-25(15-18(2)28(31)33-5)26(19(3)17-32-4)27(23)20-8-10-21(29)11-9-20/h8-13,16,18-19H,6-7,14-15,17H2,1-5H3/t18-,19?/m0/s1 |
| InChIKey | BQXXFZARCWYQHG-OYKVQYDMSA-N |
| XLogP | 6.32 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|