C13H12ClN3O4Se — CID 16875670
5,7-dimethyl-2-phenyl-[1,3,4]selenadiazolo[3,2-a]pyrimidin-4-ium perchlorate (PubChem CID 16875670) has the molecular formula C13H12ClN3O4Se and a molecular weight of 388.67 g/mol. Its IUPAC name is 5,7-dimethyl-2-phenyl-[1,3,4]selenadiazolo[3,2-a]pyrimidin-4-ium perchlorate.
| Compound Name | 5,7-dimethyl-2-phenyl-[1,3,4]selenadiazolo[3,2-a]pyrimidin-4-ium perchlorate |
|---|---|
| PubChem CID | 16875670 |
| Molecular Formula | C13H12ClN3O4Se |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 5,7-dimethyl-2-phenyl-[1,3,4]selenadiazolo[3,2-a]pyrimidin-4-ium perchlorate |
| SMILES | Cc1cc(C)[n+]2nc(-c3ccccc3)[se]c2n1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C13H12N3Se.ClHO4/c1-9-8-10(2)16-13(14-9)17-12(15-16)11-6-4-3-5-7-11;2-1(3,4)5/h3-8H,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | DBFYSDGXKOBRJZ-UHFFFAOYSA-M |
| XLogP | -3.20 |
| TPSA | 122.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|