C27H38N2O3 — CID 168757514
(Z,3aS,7aS)-N-(1-adamantyloxy)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-imine (PubChem CID 168757514) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is (Z,3aS,7aS)-N-(1-adamantyloxy)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-imine.
| Compound Name | (Z,3aS,7aS)-N-(1-adamantyloxy)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-imine |
|---|---|
| PubChem CID | 168757514 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | (Z,3aS,7aS)-N-(1-adamantyloxy)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-imine |
| SMILES | COc1ccc([C@@]23CC/C(=N/OC45CC6CC(CC(C6)C4)C5)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C27H38N2O3/c1-29-9-8-27(21-4-5-23(30-2)24(13-21)31-3)7-6-22(14-25(27)29)28-32-26-15-18-10-19(16-26)12-20(11-18)17-26/h4-5,13,18-20,25H,6-12,14-17H2,1-3H3/b28-22-/t18?,19?,20?,25-,26?,27-/m0/s1 |
| InChIKey | HICXQUDPXQWHOY-VIDLQDCFSA-N |
| XLogP | 5.17 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|