C39H31N3O2 — CID 168758447
2-[3-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)-3-phenylpyridine (PubChem CID 168758447) has the molecular formula C39H31N3O2 and a molecular weight of 573.70 g/mol. Its IUPAC name is 2-[3-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)-3-phenylpyridine.
| Compound Name | 2-[3-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)-3-phenylpyridine |
|---|---|
| PubChem CID | 168758447 |
| Molecular Formula | C39H31N3O2 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | 2-[3-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]phenyl]-4-(3-phenoxyphenyl)-3-phenylpyridine |
| SMILES | CN1C=CN(c2cccc(Oc3cccc(-c4nccc(-c5cccc(Oc6ccccc6)c5)c4-c4ccccc4)c3)c2)C1 |
| InChI | InChI=1S/C39H31N3O2/c1-41-23-24-42(28-41)32-15-10-20-36(27-32)44-35-19-9-14-31(26-35)39-38(29-11-4-2-5-12-29)37(21-22-40-39)30-13-8-18-34(25-30)43-33-16-6-3-7-17-33/h2-27H,28H2,1H3 |
| InChIKey | CXLJYZYSRZUWOG-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |