C25H24N4O3 — CID 168758750
(2S)-2-benzyl-N-cyclopropyl-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-3-oxopropanamide (PubChem CID 168758750) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is (2S)-2-benzyl-N-cyclopropyl-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-3-oxopropanamide.
| Compound Name | (2S)-2-benzyl-N-cyclopropyl-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 168758750 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (2S)-2-benzyl-N-cyclopropyl-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-3-oxopropanamide |
| SMILES | [C-]#[N+][C@@H]1C[C@@]2(CN1C(=O)[C@@H](Cc1ccccc1)C(=O)NC1CC1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C25H24N4O3/c1-26-21-14-25(19-9-5-6-10-20(19)28-24(25)32)15-29(21)23(31)18(22(30)27-17-11-12-17)13-16-7-3-2-4-8-16/h2-10,17-18,21H,11-15H2,(H,27,30)(H,28,32)/t18-,21-,25-/m0/s1 |
| InChIKey | FRVSEMHBJYRZKW-HMHJJOSWSA-N |
| XLogP | 2.49 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|