C24H21ClN8O4 — CID 168759166
4-(2-chlorophenyl)-6-methyl-N-[(1-methylpyrazol-4-yl)methyl]-2-[(7-nitro-1,3-benzoxazol-2-yl)amino]-1,4-dihydropyrimidine-5-carboxamide (PubChem CID 168759166) has the molecular formula C24H21ClN8O4 and a molecular weight of 520.94 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-6-methyl-N-[(1-methylpyrazol-4-yl)methyl]-2-[(7-nitro-1,3-benzoxazol-2-yl)amino]-1,4-dihydropyrimidine-5-carboxamide.
| Compound Name | 4-(2-chlorophenyl)-6-methyl-N-[(1-methylpyrazol-4-yl)methyl]-2-[(7-nitro-1,3-benzoxazol-2-yl)amino]-1,4-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 168759166 |
| Molecular Formula | C24H21ClN8O4 |
| Molecular Weight | 520.94 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 4-(2-chlorophenyl)-6-methyl-N-[(1-methylpyrazol-4-yl)methyl]-2-[(7-nitro-1,3-benzoxazol-2-yl)amino]-1,4-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)NCc2cnn(C)c2)C(c2ccccc2Cl)N=C(Nc2nc3cccc([N+](=O)[O-])c3o2)N1 |
| InChI | InChI=1S/C24H21ClN8O4/c1-13-19(22(34)26-10-14-11-27-32(2)12-14)20(15-6-3-4-7-16(15)25)30-23(28-13)31-24-29-17-8-5-9-18(33(35)36)21(17)37-24/h3-9,11-12,20H,10H2,1-2H3,(H,26,34)(H2,28,29,30,31) |
| InChIKey | GQCDAYFSRIMOMI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 152.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.94 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|