C21H22F2N2O2S — CID 168761484
(5S,7aR)-1'-[5-(difluoromethyl)thiophen-3-yl]-5-phenylspiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one (PubChem CID 168761484) has the molecular formula C21H22F2N2O2S and a molecular weight of 404.48 g/mol. Its IUPAC name is (5S,7aR)-1'-[5-(difluoromethyl)thiophen-3-yl]-5-phenylspiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one.
| Compound Name | (5S,7aR)-1'-[5-(difluoromethyl)thiophen-3-yl]-5-phenylspiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
|---|---|
| PubChem CID | 168761484 |
| Molecular Formula | C21H22F2N2O2S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (5S,7aR)-1'-[5-(difluoromethyl)thiophen-3-yl]-5-phenylspiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
| SMILES | O=C1N2[C@@H](CC[C@H]2c2ccccc2)OC12CCN(c1csc(C(F)F)c1)CC2 |
| InChI | InChI=1S/C21H22F2N2O2S/c22-19(23)17-12-15(13-28-17)24-10-8-21(9-11-24)20(26)25-16(6-7-18(25)27-21)14-4-2-1-3-5-14/h1-5,12-13,16,18-19H,6-11H2/t16-,18+/m0/s1 |
| InChIKey | VVGKEPNNUQJBIS-FUHWJXTLSA-N |
| XLogP | 4.74 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |