C22H26F2N4O2 — CID 168761543
5-(3,5-difluorophenyl)-1'-(5-ethyl-1,4-dihydropyrimidin-2-yl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one (PubChem CID 168761543) has the molecular formula C22H26F2N4O2 and a molecular weight of 416.47 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-1'-(5-ethyl-1,4-dihydropyrimidin-2-yl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one.
| Compound Name | 5-(3,5-difluorophenyl)-1'-(5-ethyl-1,4-dihydropyrimidin-2-yl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
|---|---|
| PubChem CID | 168761543 |
| Molecular Formula | C22H26F2N4O2 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 5-(3,5-difluorophenyl)-1'-(5-ethyl-1,4-dihydropyrimidin-2-yl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
| SMILES | CCC1=CNC(N2CCC3(CC2)OC2CCC(c4cc(F)cc(F)c4)N2C3=O)=NC1 |
| InChI | InChI=1S/C22H26F2N4O2/c1-2-14-12-25-21(26-13-14)27-7-5-22(6-8-27)20(29)28-18(3-4-19(28)30-22)15-9-16(23)11-17(24)10-15/h9-12,18-19H,2-8,13H2,1H3,(H,25,26) |
| InChIKey | BBLURPKTAMBSRC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |