C23H21F2N5O3 — CID 168761717
(5S,7aR)-5-(3,5-difluorophenyl)-1'-(imidazo[1,2-b]pyridazine-3-carbonyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one (PubChem CID 168761717) has the molecular formula C23H21F2N5O3 and a molecular weight of 453.45 g/mol. Its IUPAC name is (5S,7aR)-5-(3,5-difluorophenyl)-1'-(imidazo[1,2-b]pyridazine-3-carbonyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one.
| Compound Name | (5S,7aR)-5-(3,5-difluorophenyl)-1'-(imidazo[1,2-b]pyridazine-3-carbonyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
|---|---|
| PubChem CID | 168761717 |
| Molecular Formula | C23H21F2N5O3 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (5S,7aR)-5-(3,5-difluorophenyl)-1'-(imidazo[1,2-b]pyridazine-3-carbonyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
| SMILES | O=C(c1cnc2cccnn12)N1CCC2(CC1)O[C@@H]1CC[C@@H](c3cc(F)cc(F)c3)N1C2=O |
| InChI | InChI=1S/C23H21F2N5O3/c24-15-10-14(11-16(25)12-15)17-3-4-20-29(17)22(32)23(33-20)5-8-28(9-6-23)21(31)18-13-26-19-2-1-7-27-30(18)19/h1-2,7,10-13,17,20H,3-6,8-9H2/t17-,20+/m0/s1 |
| InChIKey | SYFAMHHJRWBBFF-FXAWDEMLSA-N |
| XLogP | 2.70 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |