About 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one
1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one (PubChem CID 168761791) has the molecular formula C13H5F7N2O
and a molecular weight of 338.18 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one.
Molecular Properties
| Compound Name | 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one |
| PubChem CID | 168761791 |
| Molecular Formula | C13H5F7N2O |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one |
| SMILES | O=C1c2c(C(F)(F)F)nn(-c3ccc(F)c(F)c3)c2CC1(F)F |
| InChI | InChI=1S/C13H5F7N2O/c14-6-2-1-5(3-7(6)15)22-8-4-12(16,17)11(23)9(8)10(21-22)13(18,19)20/h1-3H,4H2 |
| InChIKey | DPJSAODZHFQYDP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one?
The IUPAC name of 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one (CID 168761791) is 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one.
What is the SMILES notation for 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one?
The canonical SMILES for 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one is O=C1c2c(C(F)(F)F)nn(-c3ccc(F)c(F)c3)c2CC1(F)F.
What is the InChIKey of 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one?
The InChIKey is DPJSAODZHFQYDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5F7N2O/c14-6-2-1-5(3-7(6)15)22-8-4-12(16,17)11(23)9(8)10(21-22)13(18,19)20/h1-3H,4H2.
What are the key properties of 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one?
1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one has a molecular weight of 338.18 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)-5,5-difluoro-3-(trifluoromethyl)-6H-cyclopenta[c]pyrazol-4-one is sourced from PubChem (CID 168761791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).