C15H22N2O — CID 168762058
1,1,1,3,3,3-hexadeuterio-N,N-dimethyl-2-[[5-(trideuteriomethoxy)indol-1-yl]methyl]propan-2-amine (PubChem CID 168762058) has the molecular formula C15H22N2O and a molecular weight of 255.41 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexadeuterio-N,N-dimethyl-2-[[5-(trideuteriomethoxy)indol-1-yl]methyl]propan-2-amine.
| Compound Name | 1,1,1,3,3,3-hexadeuterio-N,N-dimethyl-2-[[5-(trideuteriomethoxy)indol-1-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 168762058 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 1,1,1,3,3,3-hexadeuterio-N,N-dimethyl-2-[[5-(trideuteriomethoxy)indol-1-yl]methyl]propan-2-amine |
| SMILES | [2H]C([2H])([2H])Oc1ccc2c(ccn2CC(N(C)C)(C([2H])([2H])[2H])C([2H])([2H])[2H])c1 |
| InChI | InChI=1S/C15H22N2O/c1-15(2,16(3)4)11-17-9-8-12-10-13(18-5)6-7-14(12)17/h6-10H,11H2,1-5H3/i1D3,2D3,5D3 |
| InChIKey | QNFITDXQBBUHKP-VQVNNDEWSA-N |
| XLogP | 2.99 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |