C13H17NO4S — CID 168762129
[1,1,1,2,3,3-hexadeuterio-3-(5-methoxyindol-1-yl)propan-2-yl] methanesulfonate (PubChem CID 168762129) has the molecular formula C13H17NO4S and a molecular weight of 289.39 g/mol. Its IUPAC name is [1,1,1,2,3,3-hexadeuterio-3-(5-methoxyindol-1-yl)propan-2-yl] methanesulfonate.
| Compound Name | [1,1,1,2,3,3-hexadeuterio-3-(5-methoxyindol-1-yl)propan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 168762129 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [1,1,1,2,3,3-hexadeuterio-3-(5-methoxyindol-1-yl)propan-2-yl] methanesulfonate |
| SMILES | [2H]C([2H])([2H])C([2H])(OS(C)(=O)=O)C([2H])([2H])n1ccc2cc(OC)ccc21 |
| InChI | InChI=1S/C13H17NO4S/c1-10(18-19(3,15)16)9-14-7-6-11-8-12(17-2)4-5-13(11)14/h4-8,10H,9H2,1-3H3/i1D3,9D2,10D |
| InChIKey | GSBGVSKHKRXSHK-VNEKLVNZSA-N |
| XLogP | 2.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|