C13H14ClFN2 — CID 168762160
8-chloro-9-fluoro-3-methyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole (PubChem CID 168762160) has the molecular formula C13H14ClFN2 and a molecular weight of 252.72 g/mol. Its IUPAC name is 8-chloro-9-fluoro-3-methyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole.
| Compound Name | 8-chloro-9-fluoro-3-methyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole |
|---|---|
| PubChem CID | 168762160 |
| Molecular Formula | C13H14ClFN2 |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 8-chloro-9-fluoro-3-methyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole |
| SMILES | CN1CCc2[nH]c3cc(Cl)c(F)cc3c2CC1 |
| InChI | InChI=1S/C13H14ClFN2/c1-17-4-2-8-9-6-11(15)10(14)7-13(9)16-12(8)3-5-17/h6-7,16H,2-5H2,1H3 |
| InChIKey | UCYKJHKOQKOYMN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|