C16H22N2OS — CID 168762179
8-methoxy-3-(2-methylsulfanylethyl)-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole (PubChem CID 168762179) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 8-methoxy-3-(2-methylsulfanylethyl)-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole.
| Compound Name | 8-methoxy-3-(2-methylsulfanylethyl)-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole |
|---|---|
| PubChem CID | 168762179 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 8-methoxy-3-(2-methylsulfanylethyl)-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole |
| SMILES | COc1ccc2c3c([nH]c2c1)CCN(CCSC)CC3 |
| InChI | InChI=1S/C16H22N2OS/c1-19-12-3-4-13-14-5-7-18(9-10-20-2)8-6-15(14)17-16(13)11-12/h3-4,11,17H,5-10H2,1-2H3 |
| InChIKey | WKTPUCXZZIRFPC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|