C19H30N2Si — CID 168762229
triethyl-(3-methyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-8-yl)silane (PubChem CID 168762229) has the molecular formula C19H30N2Si and a molecular weight of 314.55 g/mol. Its IUPAC name is triethyl-(3-methyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-8-yl)silane.
| Compound Name | triethyl-(3-methyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-8-yl)silane |
|---|---|
| PubChem CID | 168762229 |
| Molecular Formula | C19H30N2Si |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | triethyl-(3-methyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-8-yl)silane |
| SMILES | CC[Si](CC)(CC)c1ccc2c3c([nH]c2c1)CCN(C)CC3 |
| InChI | InChI=1S/C19H30N2Si/c1-5-22(6-2,7-3)15-8-9-16-17-10-12-21(4)13-11-18(17)20-19(16)14-15/h8-9,14,20H,5-7,10-13H2,1-4H3 |
| InChIKey | JVBRVDCSUWFGDA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|