C27H16ClN3OPt2- — CID 168763355
chloroplatinum;2-[3-[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]oxybenzene-2,6-diid-1-yl]-4-phenyl-3H-pyridin-3-ide;platinum(2+) (PubChem CID 168763355) has the molecular formula C27H16ClN3OPt2- and a molecular weight of 824.05 g/mol. Its IUPAC name is chloroplatinum;2-[3-[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]oxybenzene-2,6-diid-1-yl]-4-phenyl-3H-pyridin-3-ide;platinum(2+).
| Compound Name | chloroplatinum;2-[3-[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]oxybenzene-2,6-diid-1-yl]-4-phenyl-3H-pyridin-3-ide;platinum(2+) |
|---|---|
| PubChem CID | 168763355 |
| Molecular Formula | C27H16ClN3OPt2- |
| Molecular Weight | 824.05 g/mol |
| Exact Mass | 823.03 |
| IUPAC Name | chloroplatinum;2-[3-[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]oxybenzene-2,6-diid-1-yl]-4-phenyl-3H-pyridin-3-ide;platinum(2+) |
| SMILES | C[N+]1=C=[N+](c2[c-]c(Oc3[c-]c(-c4[c-]c(-c5[c-]cccc5)ccn4)[c-]cc3)ccc2)C=C1.Cl[Pt].[Pt+2] |
| InChI | InChI=1S/C27H16N3O.ClH.2Pt/c1-29-15-16-30(20-29)24-10-6-12-26(19-24)31-25-11-5-9-23(17-25)27-18-22(13-14-28-27)21-7-3-2-4-8-21;;;/h2-7,10-16H,1H3;1H;;/q-3;;+1;+2/p-1 |
| InChIKey | NEDHIBILIJWZHJ-UHFFFAOYSA-M |
| XLogP | 5.84 |
| TPSA | 28.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.05 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|