C18H20Cl3N5O2 — CID 168764668
2,5,6-trichloro-N-[[4-[(dimethylamino)methyl]-2-propan-2-yl-3-pyridinyl]carbamoyl]pyridine-3-carboxamide (PubChem CID 168764668) has the molecular formula C18H20Cl3N5O2 and a molecular weight of 444.75 g/mol. Its IUPAC name is 2,5,6-trichloro-N-[[4-[(dimethylamino)methyl]-2-propan-2-yl-3-pyridinyl]carbamoyl]pyridine-3-carboxamide.
| Compound Name | 2,5,6-trichloro-N-[[4-[(dimethylamino)methyl]-2-propan-2-yl-3-pyridinyl]carbamoyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 168764668 |
| Molecular Formula | C18H20Cl3N5O2 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2,5,6-trichloro-N-[[4-[(dimethylamino)methyl]-2-propan-2-yl-3-pyridinyl]carbamoyl]pyridine-3-carboxamide |
| SMILES | CC(C)c1nccc(CN(C)C)c1NC(=O)NC(=O)c1cc(Cl)c(Cl)nc1Cl |
| InChI | InChI=1S/C18H20Cl3N5O2/c1-9(2)13-14(10(5-6-22-13)8-26(3)4)23-18(28)25-17(27)11-7-12(19)16(21)24-15(11)20/h5-7,9H,8H2,1-4H3,(H2,23,25,27,28) |
| InChIKey | DYIQOCYECYGVAX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|