C13H27FN2O — CID 168764694
(1,4-ditert-butylpiperazin-2-yl)-fluoromethanol (PubChem CID 168764694) has the molecular formula C13H27FN2O and a molecular weight of 246.37 g/mol. Its IUPAC name is (1,4-ditert-butylpiperazin-2-yl)-fluoromethanol.
| Compound Name | (1,4-ditert-butylpiperazin-2-yl)-fluoromethanol |
|---|---|
| PubChem CID | 168764694 |
| Molecular Formula | C13H27FN2O |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (1,4-ditert-butylpiperazin-2-yl)-fluoromethanol |
| SMILES | CC(C)(C)N1CCN(C(C)(C)C)C(C(O)F)C1 |
| InChI | InChI=1S/C13H27FN2O/c1-12(2,3)15-7-8-16(13(4,5)6)10(9-15)11(14)17/h10-11,17H,7-9H2,1-6H3 |
| InChIKey | JWKIYUXXJIDCDO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |