About 3-phenyl-4H-pyridazin-4-ide;yttrium
3-phenyl-4H-pyridazin-4-ide;yttrium (PubChem CID 168765673) has the molecular formula C10H6N2Y-2
and a molecular weight of 243.08 g/mol. Its IUPAC name is 3-phenyl-4H-pyridazin-4-ide;yttrium.
Molecular Properties
| Compound Name | 3-phenyl-4H-pyridazin-4-ide;yttrium |
| PubChem CID | 168765673 |
| Molecular Formula | C10H6N2Y-2 |
| Molecular Weight | 243.08 g/mol |
| Exact Mass | 242.96 |
| IUPAC Name | 3-phenyl-4H-pyridazin-4-ide;yttrium |
| SMILES | [Y].[c-]1ccccc1-c1[c-]ccnn1 |
| InChI | InChI=1S/C10H6N2.Y/c1-2-5-9(6-3-1)10-7-4-8-11-12-10;/h1-5,8H;/q-2; |
| InChIKey | APZRWNJKQMWOOA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.08 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-4H-pyridazin-4-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-4H-pyridazin-4-ide;yttrium?
The IUPAC name of 3-phenyl-4H-pyridazin-4-ide;yttrium (CID 168765673) is 3-phenyl-4H-pyridazin-4-ide;yttrium.
What is the SMILES notation for 3-phenyl-4H-pyridazin-4-ide;yttrium?
The canonical SMILES for 3-phenyl-4H-pyridazin-4-ide;yttrium is [Y].[c-]1ccccc1-c1[c-]ccnn1.
What is the InChIKey of 3-phenyl-4H-pyridazin-4-ide;yttrium?
The InChIKey is APZRWNJKQMWOOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2.Y/c1-2-5-9(6-3-1)10-7-4-8-11-12-10;/h1-5,8H;/q-2;.
What are the key properties of 3-phenyl-4H-pyridazin-4-ide;yttrium?
3-phenyl-4H-pyridazin-4-ide;yttrium has a molecular weight of 243.08 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-4H-pyridazin-4-ide;yttrium is sourced from PubChem (CID 168765673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).