C74H64N2Si2 — CID 168766205
[3-[3-(1,3-ditert-butylcarbazol-9-yl)carbazol-9-yl]-5-triphenylsilylphenyl]-triphenylsilane (PubChem CID 168766205) has the molecular formula C74H64N2Si2 and a molecular weight of 1037.51 g/mol. Its IUPAC name is [3-[3-(1,3-ditert-butylcarbazol-9-yl)carbazol-9-yl]-5-triphenylsilylphenyl]-triphenylsilane.
| Compound Name | [3-[3-(1,3-ditert-butylcarbazol-9-yl)carbazol-9-yl]-5-triphenylsilylphenyl]-triphenylsilane |
|---|---|
| PubChem CID | 168766205 |
| Molecular Formula | C74H64N2Si2 |
| Molecular Weight | 1037.51 g/mol |
| Exact Mass | 1036.46 |
| IUPAC Name | [3-[3-(1,3-ditert-butylcarbazol-9-yl)carbazol-9-yl]-5-triphenylsilylphenyl]-triphenylsilane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1)c1ccccc1n2-c1ccc2c(c1)c1ccccc1n2-c1cc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C74H64N2Si2/c1-73(2,3)53-47-67-65-42-26-28-44-70(65)76(72(67)68(48-53)74(4,5)6)54-45-46-71-66(51-54)64-41-25-27-43-69(64)75(71)55-49-62(77(56-29-13-7-14-30-56,57-31-15-8-16-32-57)58-33-17-9-18-34-58)52-63(50-55)78(59-35-19-10-20-36-59,60-37-21-11-22-38-60)61-39-23-12-24-40-61/h7-52H,1-6H3 |
| InChIKey | UPWBLYKXQORXGG-UHFFFAOYSA-N |
| XLogP | 13.23 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.51 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|