C13H22N4 — CID 16876757
N',N'-dimethyl-N-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)propane-1,3-diamine (PubChem CID 16876757) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 16876757 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N',N'-dimethyl-N-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)propane-1,3-diamine |
| SMILES | Cc1nc2c(c(NCCCN(C)C)n1)CCC2 |
| InChI | InChI=1S/C13H22N4/c1-10-15-12-7-4-6-11(12)13(16-10)14-8-5-9-17(2)3/h4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | BPSJOEYANYVYIW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|