C56H37NS — CID 168767708
2,3,5,6-tetradeuterio-N-(3-dibenzothiophen-1-ylphenyl)-4-(3-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)aniline (PubChem CID 168767708) has the molecular formula C56H37NS and a molecular weight of 764.03 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-(3-dibenzothiophen-1-ylphenyl)-4-(3-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-(3-dibenzothiophen-1-ylphenyl)-4-(3-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)aniline |
|---|---|
| PubChem CID | 168767708 |
| Molecular Formula | C56H37NS |
| Molecular Weight | 764.03 g/mol |
| Exact Mass | 763.31 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-(3-dibenzothiophen-1-ylphenyl)-4-(3-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2cccc(-c3cccc4sc5ccccc5c34)c2)c2c([2H])c([2H])c(-c3cccc4ccccc34)c([2H])c2[2H])c([2H])c([2H])c1-c1cccc(-c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C56H37NS/c1-3-20-48-39(12-1)14-9-23-50(48)41-30-34-46(35-31-41)57(47-19-8-18-44(37-47)52-25-11-27-55-56(52)53-22-5-6-26-54(53)58-55)45-32-28-38(29-33-45)42-16-7-17-43(36-42)51-24-10-15-40-13-2-4-21-49(40)51/h1-37H/i28D,29D,30D,31D,32D,33D,34D,35D |
| InChIKey | POCOBDKPTWUCEU-TVWZWGCDSA-N |
| XLogP | 16.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.03 |
| LogP ≤ 5 | 16.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |