C63H38N4O2 — CID 168768833
3,9-diphenyl-6-[9-[4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole (PubChem CID 168768833) has the molecular formula C63H38N4O2 and a molecular weight of 883.02 g/mol. Its IUPAC name is 3,9-diphenyl-6-[9-[4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole.
| Compound Name | 3,9-diphenyl-6-[9-[4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole |
|---|---|
| PubChem CID | 168768833 |
| Molecular Formula | C63H38N4O2 |
| Molecular Weight | 883.02 g/mol |
| Exact Mass | 882.30 |
| IUPAC Name | 3,9-diphenyl-6-[9-[4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2cc(-c4ccc5c(c4)oc4cccc(-c6nc(-c7ccccc7)nc(-c7ccc8c(c7)oc7cccc(-c9ccccc9)c78)n6)c45)ccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C63H38N4O2/c1-5-15-39(16-6-1)42-29-33-53-51(35-42)52-36-43(30-34-54(52)67(53)46-21-11-4-12-22-46)44-27-31-49-57(37-44)69-56-26-14-24-50(60(49)56)63-65-61(41-19-9-3-10-20-41)64-62(66-63)45-28-32-48-58(38-45)68-55-25-13-23-47(59(48)55)40-17-7-2-8-18-40/h1-38H |
| InChIKey | MOSYVKCIPTZMMF-UHFFFAOYSA-N |
| XLogP | 16.77 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.02 |
| LogP ≤ 5 | 16.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |