C50H39NOSi2 — CID 168768982
N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-9,9-dimethyl-N-(3-naphthalen-1-ylphenyl)-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14,16,18-nonaen-6-amine (PubChem CID 168768982) has the molecular formula C50H39NOSi2 and a molecular weight of 726.04 g/mol. Its IUPAC name is N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-9,9-dimethyl-N-(3-naphthalen-1-ylphenyl)-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14,16,18-nonaen-6-amine.
| Compound Name | N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-9,9-dimethyl-N-(3-naphthalen-1-ylphenyl)-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14,16,18-nonaen-6-amine |
|---|---|
| PubChem CID | 168768982 |
| Molecular Formula | C50H39NOSi2 |
| Molecular Weight | 726.04 g/mol |
| Exact Mass | 725.26 |
| IUPAC Name | N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-9,9-dimethyl-N-(3-naphthalen-1-ylphenyl)-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14,16,18-nonaen-6-amine |
| SMILES | C[Si]1(C)c2ccccc2-c2c(N(c3cccc(-c4cccc5ccccc45)c3)c3ccc4c(c3)[Si](C)(C)c3ccc5c(oc6ccccc65)c3-4)cccc21 |
| InChI | InChI=1S/C50H39NOSi2/c1-53(2)44-24-10-8-20-40(44)48-42(22-13-25-45(48)53)51(34-17-11-16-33(30-34)37-21-12-15-32-14-5-6-18-36(32)37)35-26-27-41-47(31-35)54(3,4)46-29-28-39-38-19-7-9-23-43(38)52-50(39)49(41)46/h5-31H,1-4H3 |
| InChIKey | UALNCIIOVJXZGG-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.04 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|