C20H35NO3 — CID 16876963
1-[3-(1-ethynylcyclohexyl)oxy-2-hydroxypropyl]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 16876963) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is 1-[3-(1-ethynylcyclohexyl)oxy-2-hydroxypropyl]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[3-(1-ethynylcyclohexyl)oxy-2-hydroxypropyl]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 16876963 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 1-[3-(1-ethynylcyclohexyl)oxy-2-hydroxypropyl]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | C#CC1(OCC(O)CN2C(C)(C)CC(O)CC2(C)C)CCCCC1 |
| InChI | InChI=1S/C20H35NO3/c1-6-20(10-8-7-9-11-20)24-15-17(23)14-21-18(2,3)12-16(22)13-19(21,4)5/h1,16-17,22-23H,7-15H2,2-5H3 |
| InChIKey | BVBWXWSNQXQSIC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|