C21H21N5O — CID 168769636
3-[4-amino-3-(methyliminomethyl)phenyl]-6-(1,2,3,6-tetrahydropyridin-4-yl)quinazolin-4-one (PubChem CID 168769636) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-[4-amino-3-(methyliminomethyl)phenyl]-6-(1,2,3,6-tetrahydropyridin-4-yl)quinazolin-4-one.
| Compound Name | 3-[4-amino-3-(methyliminomethyl)phenyl]-6-(1,2,3,6-tetrahydropyridin-4-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 168769636 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-[4-amino-3-(methyliminomethyl)phenyl]-6-(1,2,3,6-tetrahydropyridin-4-yl)quinazolin-4-one |
| SMILES | C/N=C/c1cc(-n2cnc3ccc(C4=CCNCC4)cc3c2=O)ccc1N |
| InChI | InChI=1S/C21H21N5O/c1-23-12-16-10-17(3-4-19(16)22)26-13-25-20-5-2-15(11-18(20)21(26)27)14-6-8-24-9-7-14/h2-6,10-13,24H,7-9,22H2,1H3/b23-12+ |
| InChIKey | FNLPZCKLUVMBQI-FSJBWODESA-N |
| XLogP | 2.39 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|