C39H24N4S — CID 168770212
1,3,6,8-tetradeuterio-9-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]carbazole (PubChem CID 168770212) has the molecular formula C39H24N4S and a molecular weight of 584.74 g/mol. Its IUPAC name is 1,3,6,8-tetradeuterio-9-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]carbazole.
| Compound Name | 1,3,6,8-tetradeuterio-9-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]carbazole |
|---|---|
| PubChem CID | 168770212 |
| Molecular Formula | C39H24N4S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 1,3,6,8-tetradeuterio-9-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1)c1cc([2H])cc([2H])c1n2-c1cccc2c1sc1c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cccc12 |
| InChI | InChI=1S/C39H24N4S/c1-3-13-25(14-4-1)37-40-38(26-15-5-2-6-16-26)42-39(41-37)31-21-11-19-29-30-20-12-24-34(36(30)44-35(29)31)43-32-22-9-7-17-27(32)28-18-8-10-23-33(28)43/h1-24H/i7D,8D,22D,23D |
| InChIKey | MYYBHJAYWZYCAH-JLSOEHRSSA-N |
| XLogP | 10.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |