C39H23N3OS — CID 168770642
2-dibenzothiophen-4-yl-4-[7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazine (PubChem CID 168770642) has the molecular formula C39H23N3OS and a molecular weight of 586.73 g/mol. Its IUPAC name is 2-dibenzothiophen-4-yl-4-[7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-4-yl-4-[7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168770642 |
| Molecular Formula | C39H23N3OS |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 2-dibenzothiophen-4-yl-4-[7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)oc2cc(-c4nc(-c5ccccc5)nc(-c5cccc6c5sc5ccccc56)n4)ccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C39H23N3OS/c1-3-10-24(11-4-1)26-18-20-28-29-21-19-27(23-34(29)43-33(28)22-26)38-40-37(25-12-5-2-6-13-25)41-39(42-38)32-16-9-15-31-30-14-7-8-17-35(30)44-36(31)32/h1-23H/i1D,3D,4D,10D,11D |
| InChIKey | SXMQDDLCPBTONI-PTWMICIRSA-N |
| XLogP | 10.81 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |