C21H27N7O2 — CID 168771184
3-[2-[(7-amino-3-ethyl-6-isocyano-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]-1-(3-methoxypropyl)pyridin-2-one (PubChem CID 168771184) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-[2-[(7-amino-3-ethyl-6-isocyano-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]-1-(3-methoxypropyl)pyridin-2-one.
| Compound Name | 3-[2-[(7-amino-3-ethyl-6-isocyano-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]-1-(3-methoxypropyl)pyridin-2-one |
|---|---|
| PubChem CID | 168771184 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 3-[2-[(7-amino-3-ethyl-6-isocyano-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]-1-(3-methoxypropyl)pyridin-2-one |
| SMILES | [C-]#[N+]c1c(NCCc2cccn(CCCOC)c2=O)nc2c(CC)c(C)nn2c1N |
| InChI | InChI=1S/C21H27N7O2/c1-5-16-14(2)26-28-18(22)17(23-3)19(25-20(16)28)24-10-9-15-8-6-11-27(21(15)29)12-7-13-30-4/h6,8,11H,5,7,9-10,12-13,22H2,1-2,4H3,(H,24,25) |
| InChIKey | XRSYHUZCDHZGHK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|