C18H27BrO3Si — CID 168771430
ethyl (1S,2R)-4-bromo-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 168771430) has the molecular formula C18H27BrO3Si and a molecular weight of 399.40 g/mol. Its IUPAC name is ethyl (1S,2R)-4-bromo-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-indene-2-carboxylate.
| Compound Name | ethyl (1S,2R)-4-bromo-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 168771430 |
| Molecular Formula | C18H27BrO3Si |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | ethyl (1S,2R)-4-bromo-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Cc2c(Br)cccc2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H27BrO3Si/c1-7-21-17(20)14-11-13-12(9-8-10-15(13)19)16(14)22-23(5,6)18(2,3)4/h8-10,14,16H,7,11H2,1-6H3/t14-,16-/m1/s1 |
| InChIKey | ILIHCGOHYAMTLU-GDBMZVCRSA-N |
| XLogP | 5.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|