C22H22F14O4 — CID 168771505
bis(2,2,3,3,4,4,4-heptafluorobutyl) (1S,2R,3S,4S)-3,4-bis(but-3-enyl)cyclobutane-1,2-dicarboxylate (PubChem CID 168771505) has the molecular formula C22H22F14O4 and a molecular weight of 616.39 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,4-heptafluorobutyl) (1S,2R,3S,4S)-3,4-bis(but-3-enyl)cyclobutane-1,2-dicarboxylate.
| Compound Name | bis(2,2,3,3,4,4,4-heptafluorobutyl) (1S,2R,3S,4S)-3,4-bis(but-3-enyl)cyclobutane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 168771505 |
| Molecular Formula | C22H22F14O4 |
| Molecular Weight | 616.39 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | bis(2,2,3,3,4,4,4-heptafluorobutyl) (1S,2R,3S,4S)-3,4-bis(but-3-enyl)cyclobutane-1,2-dicarboxylate |
| SMILES | C=CCC[C@H]1[C@H](CCC=C)[C@H](C(=O)OCC(F)(F)C(F)(F)C(F)(F)F)[C@@H]1C(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H22F14O4/c1-3-5-7-11-12(8-6-4-2)14(16(38)40-10-18(25,26)20(29,30)22(34,35)36)13(11)15(37)39-9-17(23,24)19(27,28)21(31,32)33/h3-4,11-14H,1-2,5-10H2/t11-,12-,13-,14+/m0/s1 |
| InChIKey | SOFREIQKPMLYJD-XDQVBPFNSA-N |
| XLogP | 7.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.39 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|