C25H20F2N6O — CID 168776511
5,25-difluoro-11-methyl-4,7,9,13,22,29-hexazapentacyclo[22.2.2.12,6.18,12.014,19]triaconta-1(26),2(30),3,5,8,10,12(29),14,16,18,24,27-dodecaen-23-one (PubChem CID 168776511) has the molecular formula C25H20F2N6O and a molecular weight of 458.47 g/mol. Its IUPAC name is 5,25-difluoro-11-methyl-4,7,9,13,22,29-hexazapentacyclo[22.2.2.12,6.18,12.014,19]triaconta-1(26),2(30),3,5,8,10,12(29),14,16,18,24,27-dodecaen-23-one.
| Compound Name | 5,25-difluoro-11-methyl-4,7,9,13,22,29-hexazapentacyclo[22.2.2.12,6.18,12.014,19]triaconta-1(26),2(30),3,5,8,10,12(29),14,16,18,24,27-dodecaen-23-one |
|---|---|
| PubChem CID | 168776511 |
| Molecular Formula | C25H20F2N6O |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 5,25-difluoro-11-methyl-4,7,9,13,22,29-hexazapentacyclo[22.2.2.12,6.18,12.014,19]triaconta-1(26),2(30),3,5,8,10,12(29),14,16,18,24,27-dodecaen-23-one |
| SMILES | Cc1cnc2nc1Nc1ccccc1CCNC(=O)c1ccc(cc1F)-c1cnc(F)c(c1)N2 |
| InChI | InChI=1S/C25H20F2N6O/c1-14-12-30-25-32-21-11-17(13-29-22(21)27)16-6-7-18(19(26)10-16)24(34)28-9-8-15-4-2-3-5-20(15)31-23(14)33-25/h2-7,10-13H,8-9H2,1H3,(H,28,34)(H2,30,31,32,33) |
| InChIKey | MYQSCPCYNIQNAZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|