C51H34N2 — CID 168777546
4-[4-[9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluoren-4-yl]naphthalen-1-yl]-2,6-diphenylpyrimidine (PubChem CID 168777546) has the molecular formula C51H34N2 and a molecular weight of 684.91 g/mol. Its IUPAC name is 4-[4-[9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluoren-4-yl]naphthalen-1-yl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[4-[9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluoren-4-yl]naphthalen-1-yl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 168777546 |
| Molecular Formula | C51H34N2 |
| Molecular Weight | 684.91 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 4-[4-[9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluoren-4-yl]naphthalen-1-yl]-2,6-diphenylpyrimidine |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3ccccc3-c3c(-c4ccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)c5ccccc45)cccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C51H34N2/c1-5-18-35(19-6-1)47-34-48(53-50(52-47)36-20-7-2-8-21-36)42-33-32-41(39-26-13-14-27-40(39)42)43-29-17-31-46-49(43)44-28-15-16-30-45(44)51(46,37-22-9-3-10-23-37)38-24-11-4-12-25-38/h1-34H/i3D,4D,9D,10D,11D,12D,22D,23D,24D,25D |
| InChIKey | ZNDZKHOVEJQDHO-NBRIYVCPSA-N |
| XLogP | 12.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.91 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |