About 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid
6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid (PubChem CID 168781005) has the molecular formula C18H12F2O2S
and a molecular weight of 330.36 g/mol. Its IUPAC name is 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid |
| PubChem CID | 168781005 |
| Molecular Formula | C18H12F2O2S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc2cc(F)ccc2c1-c1ccc(F)c2c1CCC2 |
| InChI | InChI=1S/C18H12F2O2S/c19-9-4-5-13-15(8-9)23-17(18(21)22)16(13)12-6-7-14(20)11-3-1-2-10(11)12/h4-8H,1-3H2,(H,21,22) |
| InChIKey | CWBOMHUZKCTEAQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid?
The IUPAC name of 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid (CID 168781005) is 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid.
What is the SMILES notation for 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid?
The canonical SMILES for 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid is O=C(O)c1sc2cc(F)ccc2c1-c1ccc(F)c2c1CCC2.
What is the InChIKey of 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid?
The InChIKey is CWBOMHUZKCTEAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F2O2S/c19-9-4-5-13-15(8-9)23-17(18(21)22)16(13)12-6-7-14(20)11-3-1-2-10(11)12/h4-8H,1-3H2,(H,21,22).
What are the key properties of 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid?
6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid has a molecular weight of 330.36 g/mol, XLogP of 5.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-1-benzothiophene-2-carboxylic acid is sourced from PubChem (CID 168781005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).