About 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one
4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one (PubChem CID 168781260) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one.
Molecular Properties
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one |
| PubChem CID | 168781260 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one |
| SMILES | CC1CC(=O)CCC1C1=CCCC=C1 |
| InChI | InChI=1S/C13H18O/c1-10-9-12(14)7-8-13(10)11-5-3-2-4-6-11/h3,5-6,10,13H,2,4,7-9H2,1H3 |
| InChIKey | AFPUBLJHGAOXLK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one?
The IUPAC name of 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one (CID 168781260) is 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one.
What is the SMILES notation for 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one?
The canonical SMILES for 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one is CC1CC(=O)CCC1C1=CCCC=C1.
What is the InChIKey of 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one?
The InChIKey is AFPUBLJHGAOXLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-10-9-12(14)7-8-13(10)11-5-3-2-4-6-11/h3,5-6,10,13H,2,4,7-9H2,1H3.
What are the key properties of 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one?
4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one has a molecular weight of 190.29 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,5-dien-1-yl-3-methylcyclohexan-1-one is sourced from PubChem (CID 168781260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).