C66H56N4O — CID 168782459
CID 168782459 (PubChem CID 168782459) has the molecular formula C66H56N4O and a molecular weight of 940.32 g/mol.
| Compound Name | CID 168782459 |
|---|---|
| PubChem CID | 168782459 |
| Molecular Formula | C66H56N4O |
| Molecular Weight | 940.32 g/mol |
| Exact Mass | 939.56 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c2c(c([2H])c1-c1cccc3c4ccccc4c4ccccc4c4cccc5c4n([c-][n+]5-c4cccc(Oc5ccc6c7ccccc7n(-c7cc(C(C)(C)C)ccn7)c6c5)c4)c13)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C2(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C66H56N4O/c1-64(2,3)43-33-36-67-61(38-43)70-58-27-13-12-23-52(58)53-31-30-46(40-60(53)70)71-45-18-14-17-44(39-45)68-41-69-62-47(42-29-32-56-57(37-42)66(6,7)35-34-65(56,4)5)24-15-25-54(62)50-21-10-8-19-48(50)49-20-9-11-22-51(49)55-26-16-28-59(68)63(55)69/h8-33,36-40H,34-35H2,1-7H3/i4D3,5D3,6D3,7D3,29D,32D,34D2,35D2,37D |
| InChIKey | GUVLWANZLIMNKP-WSDKCMLJSA-N |
| XLogP | 16.79 |
| TPSA | 35.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.32 |
| LogP ≤ 5 | 16.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|