C18H25N3O7PS2Tl- — CID 168782558
CID 168782558 (PubChem CID 168782558) has the molecular formula C18H25N3O7PS2Tl- and a molecular weight of 694.90 g/mol.
| Compound Name | CID 168782558 |
|---|---|
| PubChem CID | 168782558 |
| Molecular Formula | C18H25N3O7PS2Tl- |
| Molecular Weight | 694.90 g/mol |
| Exact Mass | 695.06 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1nn(C)c2c1CCN(CC1(S(=O)(=O)C3(CO[SH-]#P)COC3)CC1)C2=O.[Tl] |
| InChI | InChI=1S/C18H25N3O7PS2.Tl/c1-3-27-16(23)13-12-4-7-21(15(22)14(12)20(2)19-13)8-17(5-6-17)31(24,25)18(9-26-10-18)11-28-30-29;/h30H,3-11H2,1-2H3;/q-1; |
| InChIKey | RRDYVMXDUSUGDX-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 117.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.90 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|